C27H22BN — CID 174016389
CID 174016389 (PubChem CID 174016389) has the molecular formula C27H22BN and a molecular weight of 371.29 g/mol.
| Compound Name | CID 174016389 |
|---|---|
| PubChem CID | 174016389 |
| Molecular Formula | C27H22BN |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(cc1Nc1ccc(-c3ccccc3)cc1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C27H22BN/c1-27(2)23-11-7-6-10-21(23)22-16-25(28)26(17-24(22)27)29-20-14-12-19(13-15-20)18-8-4-3-5-9-18/h3-17,29H,1-2H3 |
| InChIKey | MPZQQBVXSGJBGI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|