C18H21N9O2 — CID 174019707
5-[[[6-[1-amino-3-(2-hydroxyethylimino)prop-1-en-2-yl]-3-hydrazinylpyrazin-2-yl]amino]methyl]pyrazolo[1,5-a]pyridine-3-carbaldehyde (PubChem CID 174019707) has the molecular formula C18H21N9O2 and a molecular weight of 395.43 g/mol. Its IUPAC name is 5-[[[6-[1-amino-3-(2-hydroxyethylimino)prop-1-en-2-yl]-3-hydrazinylpyrazin-2-yl]amino]methyl]pyrazolo[1,5-a]pyridine-3-carbaldehyde.
| Compound Name | 5-[[[6-[1-amino-3-(2-hydroxyethylimino)prop-1-en-2-yl]-3-hydrazinylpyrazin-2-yl]amino]methyl]pyrazolo[1,5-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 174019707 |
| Molecular Formula | C18H21N9O2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 5-[[[6-[1-amino-3-(2-hydroxyethylimino)prop-1-en-2-yl]-3-hydrazinylpyrazin-2-yl]amino]methyl]pyrazolo[1,5-a]pyridine-3-carbaldehyde |
| SMILES | NC=C(/C=N/CCO)c1cnc(NN)c(NCc2ccn3ncc(C=O)c3c2)n1 |
| InChI | InChI=1S/C18H21N9O2/c19-6-13(8-21-2-4-28)15-10-23-18(26-20)17(25-15)22-7-12-1-3-27-16(5-12)14(11-29)9-24-27/h1,3,5-6,8-11,28H,2,4,7,19-20H2,(H,22,25)(H,23,26)/b13-6?,21-8+ |
| InChIKey | PYNZYZFSSXOFAS-BZXOLRGMSA-N |
| XLogP | 0.20 |
| TPSA | 168.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|