C29H31FN6O3 — CID 174020993
[N'-[(3R)-2-oxo-5-phenyl-1,3,9,9a-tetrahydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorobenzenecarboximidate (PubChem CID 174020993) has the molecular formula C29H31FN6O3 and a molecular weight of 530.60 g/mol. Its IUPAC name is [N'-[(3R)-2-oxo-5-phenyl-1,3,9,9a-tetrahydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorobenzenecarboximidate.
| Compound Name | [N'-[(3R)-2-oxo-5-phenyl-1,3,9,9a-tetrahydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorobenzenecarboximidate |
|---|---|
| PubChem CID | 174020993 |
| Molecular Formula | C29H31FN6O3 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | [N'-[(3R)-2-oxo-5-phenyl-1,3,9,9a-tetrahydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorobenzenecarboximidate |
| SMILES | [H]/N=C(/OC(N)=N[C@H]1N=C(c2ccccc2)C2=CC=CCC2NC1=O)c1ccc(F)cc1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C29H31FN6O3/c1-17-15-36(16-18(2)38-17)24-14-20(30)12-13-22(24)26(31)39-29(32)35-27-28(37)33-23-11-7-6-10-21(23)25(34-27)19-8-4-3-5-9-19/h3-10,12-14,17-18,23,27,31H,11,15-16H2,1-2H3,(H2,32,35)(H,33,37)/b31-26+/t17-,18+,23?,27-/m1/s1 |
| InChIKey | MQKSKYNKRHKSHU-FXDMDENASA-N |
| XLogP | 3.30 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|