C26H24FN7O3 — CID 174020957
[N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 2-fluoro-6-morpholin-4-ylpyridine-3-carboximidate (PubChem CID 174020957) has the molecular formula C26H24FN7O3 and a molecular weight of 501.52 g/mol. Its IUPAC name is [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 2-fluoro-6-morpholin-4-ylpyridine-3-carboximidate.
| Compound Name | [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 2-fluoro-6-morpholin-4-ylpyridine-3-carboximidate |
|---|---|
| PubChem CID | 174020957 |
| Molecular Formula | C26H24FN7O3 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 2-fluoro-6-morpholin-4-ylpyridine-3-carboximidate |
| SMILES | [H]/N=C(/OC(N)=NC1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc(N2CCOCC2)nc1F |
| InChI | InChI=1S/C26H24FN7O3/c27-22-18(10-11-20(31-22)34-12-14-36-15-13-34)23(28)37-26(29)33-24-25(35)30-19-9-5-4-8-17(19)21(32-24)16-6-2-1-3-7-16/h1-11,24,28H,12-15H2,(H2,29,33)(H,30,35)/b28-23+ |
| InChIKey | HDOQGISBNJTTEB-WEMUOSSPSA-N |
| XLogP | 2.53 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|