C26H22F5N7O3S — CID 171925105
[N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 5-morpholin-4-yl-2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-4-carboximidate (PubChem CID 171925105) has the molecular formula C26H22F5N7O3S and a molecular weight of 607.57 g/mol. Its IUPAC name is [N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 5-morpholin-4-yl-2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-4-carboximidate.
| Compound Name | [N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 5-morpholin-4-yl-2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-4-carboximidate |
|---|---|
| PubChem CID | 171925105 |
| Molecular Formula | C26H22F5N7O3S |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | [N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 5-morpholin-4-yl-2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-4-carboximidate |
| SMILES | [H]/N=C(/OC(N)=N[C@H]1N=C(c2ccccc2)c2ccccc2NC1=O)c1nc(C(F)(F)C(F)(F)F)sc1N1CCOCC1 |
| InChI | InChI=1S/C26H22F5N7O3S/c27-25(28,26(29,30)31)23-36-18(22(42-23)38-10-12-40-13-11-38)19(32)41-24(33)37-20-21(39)34-16-9-5-4-8-15(16)17(35-20)14-6-2-1-3-7-14/h1-9,20,32H,10-13H2,(H2,33,37)(H,34,39)/b32-19+/t20-/m1/s1 |
| InChIKey | ZZSFSPWUVTXWJK-YDJQKXNPSA-N |
| XLogP | 4.11 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|