C25H24N8O3 — CID 138515507
[(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-morpholin-4-ylpyrimidine-5-carboximidate (PubChem CID 138515507) has the molecular formula C25H24N8O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-morpholin-4-ylpyrimidine-5-carboximidate.
| Compound Name | [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-morpholin-4-ylpyrimidine-5-carboximidate |
|---|---|
| PubChem CID | 138515507 |
| Molecular Formula | C25H24N8O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-morpholin-4-ylpyrimidine-5-carboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/[C@H]1N=C(c2ccccc2)c2ccccc2NC1=O)c1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C25H24N8O3/c26-21(17-14-28-25(29-15-17)33-10-12-35-13-11-33)36-24(27)32-22-23(34)30-19-9-5-4-8-18(19)20(31-22)16-6-2-1-3-7-16/h1-9,14-15,22,26H,10-13H2,(H2,27,32)(H,30,34)/b26-21+/t22-/m1/s1 |
| InChIKey | YPVLNNORAWLIPZ-XDMDVORWSA-N |
| XLogP | 1.79 |
| TPSA | 151.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|