C29H26N6O4 — CID 138515028
[(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 3-morpholin-4-yl-1-benzofuran-2-carboximidate (PubChem CID 138515028) has the molecular formula C29H26N6O4 and a molecular weight of 522.57 g/mol. Its IUPAC name is [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 3-morpholin-4-yl-1-benzofuran-2-carboximidate.
| Compound Name | [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 3-morpholin-4-yl-1-benzofuran-2-carboximidate |
|---|---|
| PubChem CID | 138515028 |
| Molecular Formula | C29H26N6O4 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 3-morpholin-4-yl-1-benzofuran-2-carboximidate |
| SMILES | [H]/N=C(\O/C(N)=N/[C@H]1N=C(c2ccccc2)c2ccccc2NC1=O)c1oc2ccccc2c1N1CCOCC1 |
| InChI | InChI=1S/C29H26N6O4/c30-26(25-24(35-14-16-37-17-15-35)20-11-5-7-13-22(20)38-25)39-29(31)34-27-28(36)32-21-12-6-4-10-19(21)23(33-27)18-8-2-1-3-9-18/h1-13,27,30H,14-17H2,(H2,31,34)(H,32,36)/b30-26-/t27-/m1/s1 |
| InChIKey | XTJXRLJESSARIY-VOEFLUBFSA-N |
| XLogP | 3.74 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|