C26H28N8O3 — CID 174021157
[N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 1-ethyl-3-morpholin-4-ylpyrazole-4-carboximidate (PubChem CID 174021157) has the molecular formula C26H28N8O3 and a molecular weight of 500.56 g/mol. Its IUPAC name is [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 1-ethyl-3-morpholin-4-ylpyrazole-4-carboximidate.
| Compound Name | [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 1-ethyl-3-morpholin-4-ylpyrazole-4-carboximidate |
|---|---|
| PubChem CID | 174021157 |
| Molecular Formula | C26H28N8O3 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 1-ethyl-3-morpholin-4-ylpyrazole-4-carboximidate |
| SMILES | [H]/N=C(/OC(N)=NC1N=C(c2ccccc2)c2ccccc2NC1=O)c1cn(CC)nc1N1CCOCC1 |
| InChI | InChI=1S/C26H28N8O3/c1-2-34-16-19(24(32-34)33-12-14-36-15-13-33)22(27)37-26(28)31-23-25(35)29-20-11-7-6-10-18(20)21(30-23)17-8-4-3-5-9-17/h3-11,16,23,27H,2,12-15H2,1H3,(H2,28,31)(H,29,35)/b27-22+ |
| InChIKey | DSIVVSQZEZMVHA-HPNDGRJYSA-N |
| XLogP | 2.21 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|