C22H19N5O2S — CID 149049577
[N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-methylthiophene-2-carboximidate (PubChem CID 149049577) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-methylthiophene-2-carboximidate.
| Compound Name | [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-methylthiophene-2-carboximidate |
|---|---|
| PubChem CID | 149049577 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-methylthiophene-2-carboximidate |
| SMILES | [H]/N=C(/OC(N)=NC1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc(C)s1 |
| InChI | InChI=1S/C22H19N5O2S/c1-13-11-12-17(30-13)19(23)29-22(24)27-20-21(28)25-16-10-6-5-9-15(16)18(26-20)14-7-3-2-4-8-14/h2-12,20,23H,1H3,(H2,24,27)(H,25,28)/b23-19+ |
| InChIKey | QJNXFULVTVDZEE-FCDQGJHFSA-N |
| XLogP | 3.53 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|