C23H25ClN6O3S — CID 174021333
(1S,2S,3R,5R)-3-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclopropylamino)purin-9-yl]-2,3-dihydroxy-N,2,5-trimethylcyclopentane-1-carboxamide (PubChem CID 174021333) has the molecular formula C23H25ClN6O3S and a molecular weight of 501.01 g/mol. Its IUPAC name is (1S,2S,3R,5R)-3-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclopropylamino)purin-9-yl]-2,3-dihydroxy-N,2,5-trimethylcyclopentane-1-carboxamide.
| Compound Name | (1S,2S,3R,5R)-3-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclopropylamino)purin-9-yl]-2,3-dihydroxy-N,2,5-trimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 174021333 |
| Molecular Formula | C23H25ClN6O3S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | (1S,2S,3R,5R)-3-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclopropylamino)purin-9-yl]-2,3-dihydroxy-N,2,5-trimethylcyclopentane-1-carboxamide |
| SMILES | CNC(=O)[C@H]1[C@H](C)C[C@](O)(n2cnc3c(NC4CC4)nc(C#Cc4ccc(Cl)s4)nc32)[C@@]1(C)O |
| InChI | InChI=1S/C23H25ClN6O3S/c1-12-10-23(33,22(2,32)17(12)21(31)25-3)30-11-26-18-19(27-13-4-5-13)28-16(29-20(18)30)9-7-14-6-8-15(24)34-14/h6,8,11-13,17,32-33H,4-5,10H2,1-3H3,(H,25,31)(H,27,28,29)/t12-,17-,22+,23-/m1/s1 |
| InChIKey | JVZGUDZDVSOHJN-SBFIGXDYSA-N |
| XLogP | 2.31 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|