C21H26ClN7O2S — CID 155735661
2-[2-(5-chlorothiophen-2-yl)ethynyl]-N-propyl-7H-purin-6-amine;3-(hydroxyamino)-N-methylcyclopentane-1-carboxamide (PubChem CID 155735661) has the molecular formula C21H26ClN7O2S and a molecular weight of 476.01 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)ethynyl]-N-propyl-7H-purin-6-amine;3-(hydroxyamino)-N-methylcyclopentane-1-carboxamide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)ethynyl]-N-propyl-7H-purin-6-amine;3-(hydroxyamino)-N-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 155735661 |
| Molecular Formula | C21H26ClN7O2S |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)ethynyl]-N-propyl-7H-purin-6-amine;3-(hydroxyamino)-N-methylcyclopentane-1-carboxamide |
| SMILES | CCCNc1nc(C#Cc2ccc(Cl)s2)nc2nc[nH]c12.CNC(=O)C1CCC(NO)C1 |
| InChI | InChI=1S/C14H12ClN5S.C7H14N2O2/c1-2-7-16-13-12-14(18-8-17-12)20-11(19-13)6-4-9-3-5-10(15)21-9;1-8-7(10)5-2-3-6(4-5)9-11/h3,5,8H,2,7H2,1H3,(H2,16,17,18,19,20);5-6,9,11H,2-4H2,1H3,(H,8,10) |
| InChIKey | LMUNXHVDWOGUED-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|