C27H33BNO5 — CID 174021956
CID 174021956 (PubChem CID 174021956) has the molecular formula C27H33BNO5 and a molecular weight of 462.38 g/mol.
| Compound Name | CID 174021956 |
|---|---|
| PubChem CID | 174021956 |
| Molecular Formula | C27H33BNO5 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | — |
| SMILES | COc1ccc(COc2c(C(=O)N(C)C)cc([B]OC(C)(C)C(C)(C)O)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H33BNO5/c1-26(2,31)27(3,4)34-28-23-16-22(25(30)29(5)6)24(21-11-9-8-10-20(21)23)33-17-18-12-14-19(32-7)15-13-18/h8-16,31H,17H2,1-7H3 |
| InChIKey | FECZRGWVDYBTSW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|