C16H31BO — CID 174023475
CID 174023475 (PubChem CID 174023475) has the molecular formula C16H31BO and a molecular weight of 250.23 g/mol.
| Compound Name | CID 174023475 |
|---|---|
| PubChem CID | 174023475 |
| Molecular Formula | C16H31BO |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.25 |
| IUPAC Name | — |
| SMILES | [B]C1(C)C(C)(O)C(CC)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H31BO/c1-10-11-12(2,3)13(4,5)14(6,7)16(9,17)15(11,8)18/h11,18H,10H2,1-9H3 |
| InChIKey | XDAODVZYEORPOW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|