C6H11NS — CID 174023684
4-[(1R)-1-methylsulfanylethyl]-1,2-dihydroazete (PubChem CID 174023684) has the molecular formula C6H11NS and a molecular weight of 129.23 g/mol. Its IUPAC name is 4-[(1R)-1-methylsulfanylethyl]-1,2-dihydroazete.
| Compound Name | 4-[(1R)-1-methylsulfanylethyl]-1,2-dihydroazete |
|---|---|
| PubChem CID | 174023684 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 4-[(1R)-1-methylsulfanylethyl]-1,2-dihydroazete |
| SMILES | CS[C@H](C)C1=CCN1 |
| InChI | InChI=1S/C6H11NS/c1-5(8-2)6-3-4-7-6/h3,5,7H,4H2,1-2H3/t5-/m1/s1 |
| InChIKey | FVLCFZCDFVGAMF-RXMQYKEDSA-N |
| XLogP | 1.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |