C13H27FN2O2Si — CID 174024713
tert-butyl N-[(S)-[1-(3-fluoropropyl)pyrrolidin-3-yl]-silylmethyl]carbamate (PubChem CID 174024713) has the molecular formula C13H27FN2O2Si and a molecular weight of 290.45 g/mol. Its IUPAC name is tert-butyl N-[(S)-[1-(3-fluoropropyl)pyrrolidin-3-yl]-silylmethyl]carbamate.
| Compound Name | tert-butyl N-[(S)-[1-(3-fluoropropyl)pyrrolidin-3-yl]-silylmethyl]carbamate |
|---|---|
| PubChem CID | 174024713 |
| Molecular Formula | C13H27FN2O2Si |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | tert-butyl N-[(S)-[1-(3-fluoropropyl)pyrrolidin-3-yl]-silylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]([SiH3])C1CCN(CCCF)C1 |
| InChI | InChI=1S/C13H27FN2O2Si/c1-13(2,3)18-12(17)15-11(19)10-5-8-16(9-10)7-4-6-14/h10-11H,4-9H2,1-3,19H3,(H,15,17)/t10?,11-/m0/s1 |
| InChIKey | BVLOVVNOPOCBFS-DTIOYNMSSA-N |
| XLogP | 0.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|