C12H23FN2O2 — CID 170313052
tert-butyl-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 170313052) has the molecular formula C12H23FN2O2 and a molecular weight of 246.33 g/mol. Its IUPAC name is tert-butyl-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 170313052 |
| Molecular Formula | C12H23FN2O2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | tert-butyl-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1CCN(CCCF)C1 |
| InChI | InChI=1S/C12H23FN2O2/c1-12(2,3)15(11(16)17)10-5-8-14(9-10)7-4-6-13/h10H,4-9H2,1-3H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | OVRPVBBHVJYUGS-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |