C32H41ClN6O7 — CID 174025362
4-N-[3-[4-amino-7-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-ynyl]-1-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]benzene-1,4-dicarboxamide (PubChem CID 174025362) has the molecular formula C32H41ClN6O7 and a molecular weight of 657.17 g/mol. Its IUPAC name is 4-N-[3-[4-amino-7-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-ynyl]-1-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[3-[4-amino-7-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-ynyl]-1-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 174025362 |
| Molecular Formula | C32H41ClN6O7 |
| Molecular Weight | 657.17 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 4-N-[3-[4-amino-7-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-ynyl]-1-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]benzene-1,4-dicarboxamide |
| SMILES | Nc1ncnc2c1c(C#CCNC(=O)c1ccc(C(=O)NCCOCCOCCCCCCCl)cc1)cn2[C@H]1CC(O)C(CO)O1 |
| InChI | InChI=1S/C32H41ClN6O7/c33-11-3-1-2-4-14-44-16-17-45-15-13-36-32(43)23-9-7-22(8-10-23)31(42)35-12-5-6-24-19-39(27-18-25(41)26(20-40)46-27)30-28(24)29(34)37-21-38-30/h7-10,19,21,25-27,40-41H,1-4,11-18,20H2,(H,35,42)(H,36,43)(H2,34,37,38)/t25?,26?,27-/m1/s1 |
| InChIKey | VBDXRGTWPUZMFZ-WZDPVOGJSA-N |
| XLogP | 2.00 |
| TPSA | 183.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|