C30H39ClN4O9 — CID 171612828
1-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-4-N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]benzene-1,4-dicarboxamide (PubChem CID 171612828) has the molecular formula C30H39ClN4O9 and a molecular weight of 635.11 g/mol. Its IUPAC name is 1-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-4-N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-4-N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171612828 |
| Molecular Formula | C30H39ClN4O9 |
| Molecular Weight | 635.11 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | 1-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-4-N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]benzene-1,4-dicarboxamide |
| SMILES | O=C(NCC#Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O)c1ccc(C(=O)NCCOCCOCCCCCCCl)cc1 |
| InChI | InChI=1S/C30H39ClN4O9/c31-11-3-1-2-4-14-42-16-17-43-15-13-33-28(39)22-9-7-21(8-10-22)27(38)32-12-5-6-23-19-35(30(41)34-29(23)40)26-18-24(37)25(20-36)44-26/h7-10,19,24-26,36-37H,1-4,11-18,20H2,(H,32,38)(H,33,39)(H,34,40,41)/t24-,25+,26+/m0/s1 |
| InChIKey | JAWZBDGVKVVVBV-JIMJEQGWSA-N |
| XLogP | 0.52 |
| TPSA | 181.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.11 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|