C24H36ClN3O8 — CID 166130912
3-[1-[(2R,5S)-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate (PubChem CID 166130912) has the molecular formula C24H36ClN3O8 and a molecular weight of 530.02 g/mol. Its IUPAC name is 3-[1-[(2R,5S)-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate.
| Compound Name | 3-[1-[(2R,5S)-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166130912 |
| Molecular Formula | C24H36ClN3O8 |
| Molecular Weight | 530.02 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 3-[1-[(2R,5S)-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
| SMILES | CC1C[C@H](n2cc(C#CCOC(=O)NCCOCCOCCCCCCCl)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C24H36ClN3O8/c1-18-15-21(36-20(18)17-29)28-16-19(22(30)27-23(28)31)7-6-11-35-24(32)26-9-12-34-14-13-33-10-5-3-2-4-8-25/h16,18,20-21,29H,2-5,8-15,17H2,1H3,(H,26,32)(H,27,30,31)/t18?,20-,21-/m1/s1 |
| InChIKey | UBWKFUXHEMXEDP-VTVVEXCCSA-N |
| XLogP | 1.36 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.02 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|