C26H42F3N5O4Si — CID 174027606
N-[1-[3-[[[1-cyano-2-(6,6-dimethyl-2-oxopiperidin-3-yl)ethyl]amino]-hydroxymethyl]-2-aza-5-silaspiro[4.4]nonan-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 174027606) has the molecular formula C26H42F3N5O4Si and a molecular weight of 573.73 g/mol. Its IUPAC name is N-[1-[3-[[[1-cyano-2-(6,6-dimethyl-2-oxopiperidin-3-yl)ethyl]amino]-hydroxymethyl]-2-aza-5-silaspiro[4.4]nonan-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[3-[[[1-cyano-2-(6,6-dimethyl-2-oxopiperidin-3-yl)ethyl]amino]-hydroxymethyl]-2-aza-5-silaspiro[4.4]nonan-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 174027606 |
| Molecular Formula | C26H42F3N5O4Si |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | N-[1-[3-[[[1-cyano-2-(6,6-dimethyl-2-oxopiperidin-3-yl)ethyl]amino]-hydroxymethyl]-2-aza-5-silaspiro[4.4]nonan-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)CCC(CC(C#N)NC(O)C2C[Si]3(CCCC3)CN2C(=O)C(NC(=O)C(F)(F)F)C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C26H42F3N5O4Si/c1-24(2,3)19(32-23(38)26(27,28)29)22(37)34-15-39(10-6-7-11-39)14-18(34)21(36)31-17(13-30)12-16-8-9-25(4,5)33-20(16)35/h16-19,21,31,36H,6-12,14-15H2,1-5H3,(H,32,38)(H,33,35) |
| InChIKey | ALHZPBYLAZWAGY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|