C19H28BClFNO4 — CID 174028047
tert-butyl N-[[4-(4-chloro-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-3-fluoro-5-methylphenyl]methyl]-N-methylcarbamate (PubChem CID 174028047) has the molecular formula C19H28BClFNO4 and a molecular weight of 399.70 g/mol. Its IUPAC name is tert-butyl N-[[4-(4-chloro-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-3-fluoro-5-methylphenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[4-(4-chloro-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-3-fluoro-5-methylphenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 174028047 |
| Molecular Formula | C19H28BClFNO4 |
| Molecular Weight | 399.70 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | tert-butyl N-[[4-(4-chloro-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-3-fluoro-5-methylphenyl]methyl]-N-methylcarbamate |
| SMILES | Cc1cc(CN(C)C(=O)OC(C)(C)C)cc(F)c1B1OC(C)(C)C(C)(Cl)O1 |
| InChI | InChI=1S/C19H28BClFNO4/c1-12-9-13(11-23(8)16(24)25-17(2,3)4)10-14(22)15(12)20-26-18(5,6)19(7,21)27-20/h9-10H,11H2,1-8H3 |
| InChIKey | GTSHPFPEUKQHTO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.70 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|