C22H28BN3O4S — CID 174030809
CID 174030809 (PubChem CID 174030809) has the molecular formula C22H28BN3O4S and a molecular weight of 441.36 g/mol.
| Compound Name | CID 174030809 |
|---|---|
| PubChem CID | 174030809 |
| Molecular Formula | C22H28BN3O4S |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | — |
| SMILES | [H]N=S(=O)(NC(=O)Nc1c([C@@H](C)C2CC2)cc([B])c2c1CCC2)c1cc(C(C)(C)O)co1 |
| InChI | InChI=1S/C22H28BN3O4S/c1-12(13-7-8-13)17-10-18(23)15-5-4-6-16(15)20(17)25-21(27)26-31(24,29)19-9-14(11-30-19)22(2,3)28/h9-13,28H,4-8H2,1-3H3,(H3,24,25,26,27,29)/t12-,31?/m0/s1 |
| InChIKey | FGDCDCMYJILZJF-VBQJXAALSA-N |
| XLogP | 3.45 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|