C29H38N8O4Si — CID 174031024
2-ethoxy-6-[2-(2-hydroxypropan-2-yl)-3-methylbenzimidazol-5-yl]-8-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pteridin-7-one (PubChem CID 174031024) has the molecular formula C29H38N8O4Si and a molecular weight of 590.76 g/mol. Its IUPAC name is 2-ethoxy-6-[2-(2-hydroxypropan-2-yl)-3-methylbenzimidazol-5-yl]-8-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pteridin-7-one.
| Compound Name | 2-ethoxy-6-[2-(2-hydroxypropan-2-yl)-3-methylbenzimidazol-5-yl]-8-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pteridin-7-one |
|---|---|
| PubChem CID | 174031024 |
| Molecular Formula | C29H38N8O4Si |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 2-ethoxy-6-[2-(2-hydroxypropan-2-yl)-3-methylbenzimidazol-5-yl]-8-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pteridin-7-one |
| SMILES | CCOc1ncc2nc(-c3ccc4nc(C(C)(C)O)n(C)c4c3)c(=O)n(Cc3nccn3COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C29H38N8O4Si/c1-8-41-28-31-16-21-25(34-28)37(17-23-30-11-12-36(23)18-40-13-14-42(5,6)7)26(38)24(32-21)19-9-10-20-22(15-19)35(4)27(33-20)29(2,3)39/h9-12,15-16,39H,8,13-14,17-18H2,1-7H3 |
| InChIKey | LWLSAQNNRURMCZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|