C36H42ClN3O3 — CID 174033050
(5E,11S)-18-(4-chloro-2-propylphenyl)-8-methyl-N-(4-methylphenyl)-9-oxo-16-oxa-1,8-diazatricyclo[10.7.2.015,20]henicosa-5,12(21),13,15(20)-tetraene-11-carboxamide (PubChem CID 174033050) has the molecular formula C36H42ClN3O3 and a molecular weight of 600.20 g/mol. Its IUPAC name is (5E,11S)-18-(4-chloro-2-propylphenyl)-8-methyl-N-(4-methylphenyl)-9-oxo-16-oxa-1,8-diazatricyclo[10.7.2.015,20]henicosa-5,12(21),13,15(20)-tetraene-11-carboxamide.
| Compound Name | (5E,11S)-18-(4-chloro-2-propylphenyl)-8-methyl-N-(4-methylphenyl)-9-oxo-16-oxa-1,8-diazatricyclo[10.7.2.015,20]henicosa-5,12(21),13,15(20)-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 174033050 |
| Molecular Formula | C36H42ClN3O3 |
| Molecular Weight | 600.20 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | (5E,11S)-18-(4-chloro-2-propylphenyl)-8-methyl-N-(4-methylphenyl)-9-oxo-16-oxa-1,8-diazatricyclo[10.7.2.015,20]henicosa-5,12(21),13,15(20)-tetraene-11-carboxamide |
| SMILES | CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(CCC/C=C\CN(C)C(=O)C[C@@H]3C(=O)Nc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C36H42ClN3O3/c1-4-9-26-20-29(37)13-16-31(26)28-23-40-19-8-6-5-7-18-39(3)35(41)22-32(27-12-17-34(43-24-28)33(40)21-27)36(42)38-30-14-10-25(2)11-15-30/h5,7,10-17,20-21,28,32H,4,6,8-9,18-19,22-24H2,1-3H3,(H,38,42)/b7-5-/t28?,32-/m0/s1 |
| InChIKey | ZQJVRPLKUHAFJG-OYUDDAHVSA-N |
| XLogP | 7.50 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.20 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|