C31H41ClN2O4 — CID 153341363
(6E)-20-(4-chloro-2-propylphenyl)-9-methyl-18-oxa-1,9-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraen-10-one;formic acid (PubChem CID 153341363) has the molecular formula C31H41ClN2O4 and a molecular weight of 541.13 g/mol. Its IUPAC name is (6E)-20-(4-chloro-2-propylphenyl)-9-methyl-18-oxa-1,9-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraen-10-one;formic acid.
| Compound Name | (6E)-20-(4-chloro-2-propylphenyl)-9-methyl-18-oxa-1,9-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraen-10-one;formic acid |
|---|---|
| PubChem CID | 153341363 |
| Molecular Formula | C31H41ClN2O4 |
| Molecular Weight | 541.13 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | (6E)-20-(4-chloro-2-propylphenyl)-9-methyl-18-oxa-1,9-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraen-10-one;formic acid |
| SMILES | CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(CCCC/C=C\CN(C)C(=O)CCC3)C1.O=CO |
| InChI | InChI=1S/C30H39ClN2O2.CH2O2/c1-3-10-24-20-26(31)14-15-27(24)25-21-33-18-8-6-4-5-7-17-32(2)30(34)12-9-11-23-13-16-29(35-22-25)28(33)19-23;2-1-3/h5,7,13-16,19-20,25H,3-4,6,8-12,17-18,21-22H2,1-2H3;1H,(H,2,3)/b7-5-; |
| InChIKey | CQLXRTZQCQRYGU-YJOCEBFMSA-N |
| XLogP | 6.50 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.13 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|