C35H13F9N6O2 — CID 174035017
2-[8-[2-[2,4-bis(trifluoromethyl)phenyl]phenyl]-2-(dicyanomethylidene)-4-[2-(trifluoromethyl)phenyl]-3,7-dihydro-[1,3]oxazolo[5,4-f][1,3]benzoxazol-6-ylidene]propanedinitrile (PubChem CID 174035017) has the molecular formula C35H13F9N6O2 and a molecular weight of 720.51 g/mol. Its IUPAC name is 2-[8-[2-[2,4-bis(trifluoromethyl)phenyl]phenyl]-2-(dicyanomethylidene)-4-[2-(trifluoromethyl)phenyl]-3,7-dihydro-[1,3]oxazolo[5,4-f][1,3]benzoxazol-6-ylidene]propanedinitrile.
| Compound Name | 2-[8-[2-[2,4-bis(trifluoromethyl)phenyl]phenyl]-2-(dicyanomethylidene)-4-[2-(trifluoromethyl)phenyl]-3,7-dihydro-[1,3]oxazolo[5,4-f][1,3]benzoxazol-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174035017 |
| Molecular Formula | C35H13F9N6O2 |
| Molecular Weight | 720.51 g/mol |
| Exact Mass | 720.10 |
| IUPAC Name | 2-[8-[2-[2,4-bis(trifluoromethyl)phenyl]phenyl]-2-(dicyanomethylidene)-4-[2-(trifluoromethyl)phenyl]-3,7-dihydro-[1,3]oxazolo[5,4-f][1,3]benzoxazol-6-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1Nc2c(c(-c3ccccc3-c3ccc(C(F)(F)F)cc3C(F)(F)F)c3c(c2-c2ccccc2C(F)(F)F)OC(=C(C#N)C#N)N3)O1 |
| InChI | InChI=1S/C35H13F9N6O2/c36-33(37,38)18-9-10-20(24(11-18)35(42,43)44)19-5-1-2-6-21(19)25-27-30(52-31(49-27)16(12-45)13-46)26(22-7-3-4-8-23(22)34(39,40)41)28-29(25)51-32(50-28)17(14-47)15-48/h1-11,49-50H |
| InChIKey | GERJDSCPGZLBOY-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.51 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|