C23H25N5O — CID 174035462
6-(2-amino-4-methyliminobut-2-enyl)-3-benzyl-2,4-dihydro-1H-pyrido[3,4-c][1,8]naphthyridin-5-one (PubChem CID 174035462) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 6-(2-amino-4-methyliminobut-2-enyl)-3-benzyl-2,4-dihydro-1H-pyrido[3,4-c][1,8]naphthyridin-5-one.
| Compound Name | 6-(2-amino-4-methyliminobut-2-enyl)-3-benzyl-2,4-dihydro-1H-pyrido[3,4-c][1,8]naphthyridin-5-one |
|---|---|
| PubChem CID | 174035462 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 6-(2-amino-4-methyliminobut-2-enyl)-3-benzyl-2,4-dihydro-1H-pyrido[3,4-c][1,8]naphthyridin-5-one |
| SMILES | C/N=C/C=C(N)Cn1c(=O)c2c(c3cccnc31)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H25N5O/c1-25-12-9-18(24)15-28-22-20(8-5-11-26-22)19-10-13-27(16-21(19)23(28)29)14-17-6-3-2-4-7-17/h2-9,11-12H,10,13-16,24H2,1H3/b18-9?,25-12+ |
| InChIKey | XWEXEQDMNYUGCG-JEMDKBOOSA-N |
| XLogP | 2.50 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|