C19H16ClN3O3 — CID 175402716
6-[(3-chlorophenyl)methyl]-5-oxo-2,4-dihydro-1H-pyrido[3,4-c][1,8]naphthyridine-3-carboxylic acid (PubChem CID 175402716) has the molecular formula C19H16ClN3O3 and a molecular weight of 369.81 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methyl]-5-oxo-2,4-dihydro-1H-pyrido[3,4-c][1,8]naphthyridine-3-carboxylic acid.
| Compound Name | 6-[(3-chlorophenyl)methyl]-5-oxo-2,4-dihydro-1H-pyrido[3,4-c][1,8]naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175402716 |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 6-[(3-chlorophenyl)methyl]-5-oxo-2,4-dihydro-1H-pyrido[3,4-c][1,8]naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)N1CCc2c(c(=O)n(Cc3cccc(Cl)c3)c3ncccc23)C1 |
| InChI | InChI=1S/C19H16ClN3O3/c20-13-4-1-3-12(9-13)10-23-17-15(5-2-7-21-17)14-6-8-22(19(25)26)11-16(14)18(23)24/h1-5,7,9H,6,8,10-11H2,(H,25,26) |
| InChIKey | XWNKJAQUHZPGLD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|