C27H26N4O3 — CID 121468607
5-[2-[8-[(3-ethylphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]pyridine-2-carboxylic acid (PubChem CID 121468607) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 5-[2-[8-[(3-ethylphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[2-[8-[(3-ethylphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 121468607 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 5-[2-[8-[(3-ethylphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]pyridine-2-carboxylic acid |
| SMILES | CCc1cccc(Cn2c3c(c4cccnc42)CCN(C(=O)Cc2ccc(C(=O)O)nc2)C3)c1 |
| InChI | InChI=1S/C27H26N4O3/c1-2-18-5-3-6-20(13-18)16-31-24-17-30(12-10-21(24)22-7-4-11-28-26(22)31)25(32)14-19-8-9-23(27(33)34)29-15-19/h3-9,11,13,15H,2,10,12,14,16-17H2,1H3,(H,33,34) |
| InChIKey | QILDNCDBCWSTIV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |