C27H23F2N3O4 — CID 56597978
4-[2-[8-[(3,5-difluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]-2-methoxybenzoic acid (PubChem CID 56597978) has the molecular formula C27H23F2N3O4 and a molecular weight of 491.49 g/mol. Its IUPAC name is 4-[2-[8-[(3,5-difluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]-2-methoxybenzoic acid.
| Compound Name | 4-[2-[8-[(3,5-difluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 56597978 |
| Molecular Formula | C27H23F2N3O4 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 4-[2-[8-[(3,5-difluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]-2-methoxybenzoic acid |
| SMILES | COc1cc(CC(=O)N2CCc3c(n(Cc4cc(F)cc(F)c4)c4ncccc34)C2)ccc1C(=O)O |
| InChI | InChI=1S/C27H23F2N3O4/c1-36-24-11-16(4-5-22(24)27(34)35)12-25(33)31-8-6-20-21-3-2-7-30-26(21)32(23(20)15-31)14-17-9-18(28)13-19(29)10-17/h2-5,7,9-11,13H,6,8,12,14-15H2,1H3,(H,34,35) |
| InChIKey | NAORMVWYSGLIBM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |