C28H24F3N3O3 — CID 121468534
2-methyl-4-[2-oxo-2-[8-[[4-(trifluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethyl]benzoic acid (PubChem CID 121468534) has the molecular formula C28H24F3N3O3 and a molecular weight of 507.51 g/mol. Its IUPAC name is 2-methyl-4-[2-oxo-2-[8-[[4-(trifluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethyl]benzoic acid.
| Compound Name | 2-methyl-4-[2-oxo-2-[8-[[4-(trifluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 121468534 |
| Molecular Formula | C28H24F3N3O3 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 2-methyl-4-[2-oxo-2-[8-[[4-(trifluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethyl]benzoic acid |
| SMILES | Cc1cc(CC(=O)N2CCc3c(n(Cc4ccc(C(F)(F)F)cc4)c4ncccc34)C2)ccc1C(=O)O |
| InChI | InChI=1S/C28H24F3N3O3/c1-17-13-19(6-9-21(17)27(36)37)14-25(35)33-12-10-22-23-3-2-11-32-26(23)34(24(22)16-33)15-18-4-7-20(8-5-18)28(29,30)31/h2-9,11,13H,10,12,14-16H2,1H3,(H,36,37) |
| InChIKey | OSEBCYGLZJVZJH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |