C28H35N3O4 — CID 121468593
2,2-dimethyl-6-oxo-6-[8-[(4-propan-2-yloxyphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]hexanoic acid (PubChem CID 121468593) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is 2,2-dimethyl-6-oxo-6-[8-[(4-propan-2-yloxyphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]hexanoic acid.
| Compound Name | 2,2-dimethyl-6-oxo-6-[8-[(4-propan-2-yloxyphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]hexanoic acid |
|---|---|
| PubChem CID | 121468593 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 2,2-dimethyl-6-oxo-6-[8-[(4-propan-2-yloxyphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]hexanoic acid |
| SMILES | CC(C)Oc1ccc(Cn2c3c(c4cccnc42)CCN(C(=O)CCCC(C)(C)C(=O)O)C3)cc1 |
| InChI | InChI=1S/C28H35N3O4/c1-19(2)35-21-11-9-20(10-12-21)17-31-24-18-30(25(32)8-5-14-28(3,4)27(33)34)16-13-22(24)23-7-6-15-29-26(23)31/h6-7,9-12,15,19H,5,8,13-14,16-18H2,1-4H3,(H,33,34) |
| InChIKey | UZQGCAWFWHXNQL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |