C26H28F3N3O3 — CID 121468616
3,3-dimethyl-6-oxo-6-[8-[[3-(trifluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]hexanoic acid (PubChem CID 121468616) has the molecular formula C26H28F3N3O3 and a molecular weight of 487.52 g/mol. Its IUPAC name is 3,3-dimethyl-6-oxo-6-[8-[[3-(trifluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]hexanoic acid.
| Compound Name | 3,3-dimethyl-6-oxo-6-[8-[[3-(trifluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]hexanoic acid |
|---|---|
| PubChem CID | 121468616 |
| Molecular Formula | C26H28F3N3O3 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 3,3-dimethyl-6-oxo-6-[8-[[3-(trifluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]hexanoic acid |
| SMILES | CC(C)(CCC(=O)N1CCc2c(n(Cc3cccc(C(F)(F)F)c3)c3ncccc23)C1)CC(=O)O |
| InChI | InChI=1S/C26H28F3N3O3/c1-25(2,14-23(34)35)10-8-22(33)31-12-9-19-20-7-4-11-30-24(20)32(21(19)16-31)15-17-5-3-6-18(13-17)26(27,28)29/h3-7,11,13H,8-10,12,14-16H2,1-2H3,(H,34,35) |
| InChIKey | SDHYPKVNXFSXIQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |