C24H26F3N3OS — CID 121468553
2-cyclohexyl-1-[8-[[5-(trifluoromethyl)thiophen-3-yl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethanone (PubChem CID 121468553) has the molecular formula C24H26F3N3OS and a molecular weight of 461.55 g/mol. Its IUPAC name is 2-cyclohexyl-1-[8-[[5-(trifluoromethyl)thiophen-3-yl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethanone.
| Compound Name | 2-cyclohexyl-1-[8-[[5-(trifluoromethyl)thiophen-3-yl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethanone |
|---|---|
| PubChem CID | 121468553 |
| Molecular Formula | C24H26F3N3OS |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-cyclohexyl-1-[8-[[5-(trifluoromethyl)thiophen-3-yl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethanone |
| SMILES | O=C(CC1CCCCC1)N1CCc2c(n(Cc3csc(C(F)(F)F)c3)c3ncccc23)C1 |
| InChI | InChI=1S/C24H26F3N3OS/c25-24(26,27)21-11-17(15-32-21)13-30-20-14-29(22(31)12-16-5-2-1-3-6-16)10-8-18(20)19-7-4-9-28-23(19)30/h4,7,9,11,15-16H,1-3,5-6,8,10,12-14H2 |
| InChIKey | LZNCFVNRKCYLOR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |