C26H29F2N3O — CID 121468571
2-cyclohexyl-1-[8-[[4-(difluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethanone (PubChem CID 121468571) has the molecular formula C26H29F2N3O and a molecular weight of 437.53 g/mol. Its IUPAC name is 2-cyclohexyl-1-[8-[[4-(difluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethanone.
| Compound Name | 2-cyclohexyl-1-[8-[[4-(difluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethanone |
|---|---|
| PubChem CID | 121468571 |
| Molecular Formula | C26H29F2N3O |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-cyclohexyl-1-[8-[[4-(difluoromethyl)phenyl]methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]ethanone |
| SMILES | O=C(CC1CCCCC1)N1CCc2c(n(Cc3ccc(C(F)F)cc3)c3ncccc23)C1 |
| InChI | InChI=1S/C26H29F2N3O/c27-25(28)20-10-8-19(9-11-20)16-31-23-17-30(24(32)15-18-5-2-1-3-6-18)14-12-21(23)22-7-4-13-29-26(22)31/h4,7-11,13,18,25H,1-3,5-6,12,14-17H2 |
| InChIKey | ASXBBBWCNKEOFT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |