C23H21ClN4O — CID 166473129
7-benzyl-11-[(3-chlorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 166473129) has the molecular formula C23H21ClN4O and a molecular weight of 404.90 g/mol. Its IUPAC name is 7-benzyl-11-[(3-chlorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 7-benzyl-11-[(3-chlorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 166473129 |
| Molecular Formula | C23H21ClN4O |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 7-benzyl-11-[(3-chlorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | O=c1c2c(n3ccnc3n1Cc1ccccc1)CCN(Cc1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C23H21ClN4O/c24-19-8-4-7-18(13-19)14-26-11-9-21-20(16-26)22(29)28(23-25-10-12-27(21)23)15-17-5-2-1-3-6-17/h1-8,10,12-13H,9,11,14-16H2 |
| InChIKey | BCQBBMZNKHBYNC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |