C29H29ClN4O3 — CID 175402740
5-benzyl-6-[11-[(3-chlorophenyl)methyl]-8-oxo-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-3-oxohexanal (PubChem CID 175402740) has the molecular formula C29H29ClN4O3 and a molecular weight of 517.03 g/mol. Its IUPAC name is 5-benzyl-6-[11-[(3-chlorophenyl)methyl]-8-oxo-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-3-oxohexanal.
| Compound Name | 5-benzyl-6-[11-[(3-chlorophenyl)methyl]-8-oxo-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-3-oxohexanal |
|---|---|
| PubChem CID | 175402740 |
| Molecular Formula | C29H29ClN4O3 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 5-benzyl-6-[11-[(3-chlorophenyl)methyl]-8-oxo-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-3-oxohexanal |
| SMILES | O=CCC(=O)CC(Cc1ccccc1)Cn1c(=O)c2c(n3ccnc13)CCN(Cc1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C29H29ClN4O3/c30-24-8-4-7-22(16-24)18-32-12-9-27-26(20-32)28(37)34(29-31-11-13-33(27)29)19-23(17-25(36)10-14-35)15-21-5-2-1-3-6-21/h1-8,11,13-14,16,23H,9-10,12,15,17-20H2 |
| InChIKey | MKHLGUUWDFBBOP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|