C25H26N4O2 — CID 166473101
7-[(4-methoxyphenyl)methyl]-11-[(3-methylphenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 166473101) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 7-[(4-methoxyphenyl)methyl]-11-[(3-methylphenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 7-[(4-methoxyphenyl)methyl]-11-[(3-methylphenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 166473101 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 7-[(4-methoxyphenyl)methyl]-11-[(3-methylphenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | COc1ccc(Cn2c(=O)c3c(n4ccnc24)CCN(Cc2cccc(C)c2)C3)cc1 |
| InChI | InChI=1S/C25H26N4O2/c1-18-4-3-5-20(14-18)15-27-12-10-23-22(17-27)24(30)29(25-26-11-13-28(23)25)16-19-6-8-21(31-2)9-7-19/h3-9,11,13-14H,10,12,15-17H2,1-2H3 |
| InChIKey | LPHWKOISSZTJPZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |