C22H19B3FN9O3 — CID 174037329
CID 174037329 (PubChem CID 174037329) has the molecular formula C22H19B3FN9O3 and a molecular weight of 508.89 g/mol.
| Compound Name | CID 174037329 |
|---|---|
| PubChem CID | 174037329 |
| Molecular Formula | C22H19B3FN9O3 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1cnc(Nc2ccc(OC)nn2)cc1Nc1cc(F)cc(-c2cnn(C)n2)c1OC |
| InChI | InChI=1S/C22H19B3FN9O3/c1-35-28-10-16(34-35)12-6-11(26)7-15(20(12)38-3)29-14-8-18(30-17-4-5-19(37-2)33-32-17)27-9-13(14)21(36)31-22(23,24)25/h4-10H,1-3H3,(H,31,36)(H2,27,29,30,32) |
| InChIKey | BOBGZVIHROEYQX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|