About CID 174037006
CID 174037006 (PubChem CID 174037006) has the molecular formula C22H22B3FN8O5S
and a molecular weight of 561.97 g/mol.
Molecular Properties
| Compound Name | CID 174037006 |
| PubChem CID | 174037006 |
| Molecular Formula | C22H22B3FN8O5S |
| Molecular Weight | 561.97 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cc(F)cc(-c2cc(NS(C)(=O)=O)n(C)n2)c1OC |
| InChI | InChI=1S/C22H22B3FN8O5S/c1-34-17(33-40(3,37)38)9-13(32-34)12-6-11(26)7-15(19(12)39-2)27-14-8-16(28-20(35)10-4-5-10)30-31-18(14)21(36)29-22(23,24)25/h6-10,33H,4-5H2,1-3H3,(H,29,36)(H2,27,28,30,35) |
| InChIKey | PPRQRGYUYZQABS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 169.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 561.97 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174037006 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174037006?
The IUPAC name of CID 174037006 (CID 174037006) is not available.
What is the SMILES notation for CID 174037006?
The canonical SMILES for CID 174037006 is [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cc(F)cc(-c2cc(NS(C)(=O)=O)n(C)n2)c1OC.
What is the InChIKey of CID 174037006?
The InChIKey is PPRQRGYUYZQABS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22B3FN8O5S/c1-34-17(33-40(3,37)38)9-13(32-34)12-6-11(26)7-15(19(12)39-2)27-14-8-16(28-20(35)10-4-5-10)30-31-18(14)21(36)29-22(23,24)25/h6-10,33H,4-5H2,1-3H3,(H,29,36)(H2,27,28,30,35).
What are the key properties of CID 174037006?
CID 174037006 has a molecular weight of 561.97 g/mol, XLogP of 0.34, 10 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174037006 is sourced from PubChem (CID 174037006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).