C22H22B3FN8O5S — CID 174037006
CID 174037006 (PubChem CID 174037006) has the molecular formula C22H22B3FN8O5S and a molecular weight of 561.97 g/mol.
| Compound Name | CID 174037006 |
|---|---|
| PubChem CID | 174037006 |
| Molecular Formula | C22H22B3FN8O5S |
| Molecular Weight | 561.97 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cc(F)cc(-c2cc(NS(C)(=O)=O)n(C)n2)c1OC |
| InChI | InChI=1S/C22H22B3FN8O5S/c1-34-17(33-40(3,37)38)9-13(32-34)12-6-11(26)7-15(19(12)39-2)27-14-8-16(28-20(35)10-4-5-10)30-31-18(14)21(36)29-22(23,24)25/h6-10,33H,4-5H2,1-3H3,(H,29,36)(H2,27,28,30,35) |
| InChIKey | PPRQRGYUYZQABS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 169.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.97 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|