C27H29B3N8O4 — CID 174037209
CID 174037209 (PubChem CID 174037209) has the molecular formula C27H29B3N8O4 and a molecular weight of 562.02 g/mol.
| Compound Name | CID 174037209 |
|---|---|
| PubChem CID | 174037209 |
| Molecular Formula | C27H29B3N8O4 |
| Molecular Weight | 562.02 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2cc(C(=O)N3CCCCC3)n(C)n2)c1OC |
| InChI | InChI=1S/C27H29B3N8O4/c1-37-20(26(41)38-11-4-3-5-12-38)13-18(36-37)16-7-6-8-17(23(16)42-2)31-19-14-21(32-24(39)15-9-10-15)34-35-22(19)25(40)33-27(28,29)30/h6-8,13-15H,3-5,9-12H2,1-2H3,(H,33,40)(H2,31,32,34,39) |
| InChIKey | MBWAPFZYDAYHNB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.02 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|