C26H31B3N8O4 — CID 174037192
CID 174037192 (PubChem CID 174037192) has the molecular formula C26H31B3N8O4 and a molecular weight of 552.02 g/mol.
| Compound Name | CID 174037192 |
|---|---|
| PubChem CID | 174037192 |
| Molecular Formula | C26H31B3N8O4 |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ccn(CCNC[C@H](O)CC)n2)c1OC |
| InChI | InChI=1S/C26H31B3N8O4/c1-3-16(38)14-30-10-12-37-11-9-18(36-37)17-5-4-6-19(23(17)41-2)31-20-13-21(32-24(39)15-7-8-15)34-35-22(20)25(40)33-26(27,28)29/h4-6,9,11,13,15-16,30,38H,3,7-8,10,12,14H2,1-2H3,(H,33,40)(H2,31,32,34,39)/t16-/m1/s1 |
| InChIKey | JDKDOCREZQTOLB-MRXNPFEDSA-N |
| XLogP | 0.65 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|