C26H30B3N9O5 — CID 174037190
CID 174037190 (PubChem CID 174037190) has the molecular formula C26H30B3N9O5 and a molecular weight of 581.02 g/mol.
| Compound Name | CID 174037190 |
|---|---|
| PubChem CID | 174037190 |
| Molecular Formula | C26H30B3N9O5 |
| Molecular Weight | 581.02 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2cnn(CCNC(=O)OC(C)(C)C)n2)c1OC |
| InChI | InChI=1S/C26H30B3N9O5/c1-25(2,3)43-24(41)30-10-11-38-31-13-18(37-38)15-6-5-7-16(21(15)42-4)32-17-12-19(33-22(39)14-8-9-14)35-36-20(17)23(40)34-26(27,28)29/h5-7,12-14H,8-11H2,1-4H3,(H,30,41)(H,34,40)(H2,32,33,35,39) |
| InChIKey | GDPVECJKONBLTA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.02 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|