C25H24B3N7O4S — CID 174036894
CID 174036894 (PubChem CID 174036894) has the molecular formula C25H24B3N7O4S and a molecular weight of 551.02 g/mol.
| Compound Name | CID 174036894 |
|---|---|
| PubChem CID | 174036894 |
| Molecular Formula | C25H24B3N7O4S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ncc(C(=O)N3CCC3C)s2)c1OC |
| InChI | InChI=1S/C25H24B3N7O4S/c1-12-8-9-35(12)24(38)17-11-29-23(40-17)14-4-3-5-15(20(14)39-2)30-16-10-18(31-21(36)13-6-7-13)33-34-19(16)22(37)32-25(26,27)28/h3-5,10-13H,6-9H2,1-2H3,(H,32,37)(H2,30,31,33,36) |
| InChIKey | PGZHWOSCTFMXHA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|