About CID 174036977
CID 174036977 (PubChem CID 174036977) has the molecular formula C29H32B3N7O5S
and a molecular weight of 623.12 g/mol.
Molecular Properties
| Compound Name | CID 174036977 |
| PubChem CID | 174036977 |
| Molecular Formula | C29H32B3N7O5S |
| Molecular Weight | 623.12 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ncc(CC(=O)N3CCC(CCO)CC3)s2)c1OC |
| InChI | InChI=1S/C29H32B3N7O5S/c1-44-25-19(28-33-15-18(45-28)13-23(41)39-10-7-16(8-11-39)9-12-40)3-2-4-20(25)34-21-14-22(35-26(42)17-5-6-17)37-38-24(21)27(43)36-29(30,31)32/h2-4,14-17,40H,5-13H2,1H3,(H,36,43)(H2,34,35,37,42) |
| InChIKey | SOACOHINCMCBLI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 158.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 623.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174036977 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174036977?
The IUPAC name of CID 174036977 (CID 174036977) is not available.
What is the SMILES notation for CID 174036977?
The canonical SMILES for CID 174036977 is [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ncc(CC(=O)N3CCC(CCO)CC3)s2)c1OC.
What is the InChIKey of CID 174036977?
The InChIKey is SOACOHINCMCBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32B3N7O5S/c1-44-25-19(28-33-15-18(45-28)13-23(41)39-10-7-16(8-11-39)9-12-40)3-2-4-20(25)34-21-14-22(35-26(42)17-5-6-17)37-38-24(21)27(43)36-29(30,31)32/h2-4,14-17,40H,5-13H2,1H3,(H,36,43)(H2,34,35,37,42).
What are the key properties of CID 174036977?
CID 174036977 has a molecular weight of 623.12 g/mol, XLogP of 1.71, 12 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174036977 is sourced from PubChem (CID 174036977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).