C26H28B3N9O6 — CID 174036964
CID 174036964 (PubChem CID 174036964) has the molecular formula C26H28B3N9O6 and a molecular weight of 595.00 g/mol.
| Compound Name | CID 174036964 |
|---|---|
| PubChem CID | 174036964 |
| Molecular Formula | C26H28B3N9O6 |
| Molecular Weight | 595.00 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2nc(CN3CCN(C(=O)OC)CC3)no2)c1OC |
| InChI | InChI=1S/C26H28B3N9O6/c1-42-21-15(24-32-19(36-44-24)13-37-8-10-38(11-9-37)25(41)43-2)4-3-5-16(21)30-17-12-18(31-22(39)14-6-7-14)34-35-20(17)23(40)33-26(27,28)29/h3-5,12,14H,6-11,13H2,1-2H3,(H,33,40)(H2,30,31,34,39) |
| InChIKey | GCDCCGQHCLNHEB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 176.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.00 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|