C25H25B3N10O4 — CID 174037068
CID 174037068 (PubChem CID 174037068) has the molecular formula C25H25B3N10O4 and a molecular weight of 561.98 g/mol.
| Compound Name | CID 174037068 |
|---|---|
| PubChem CID | 174037068 |
| Molecular Formula | C25H25B3N10O4 |
| Molecular Weight | 561.98 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(Nc2ccc(C)nn2)cc1Nc1cccc(-c2nc(CN3CCOCC3)no2)c1OC |
| InChI | InChI=1S/C25H25B3N10O4/c1-14-6-7-18(34-33-14)30-19-12-17(21(36-35-19)23(39)32-25(26,27)28)29-16-5-3-4-15(22(16)40-2)24-31-20(37-42-24)13-38-8-10-41-11-9-38/h3-7,12H,8-11,13H2,1-2H3,(H,32,39)(H2,29,30,34,35) |
| InChIKey | RPGVMJLIBGYRFX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 165.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.98 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|