C27H30B3N7O5 — CID 174037160
CID 174037160 (PubChem CID 174037160) has the molecular formula C27H30B3N7O5 and a molecular weight of 565.02 g/mol.
| Compound Name | CID 174037160 |
|---|---|
| PubChem CID | 174037160 |
| Molecular Formula | C27H30B3N7O5 |
| Molecular Weight | 565.02 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1cnc(NC(=O)C2CC2)cc1Nc1cccc(-c2nc(CN3C[C@@H](C)O[C@@H](C)C3)no2)c1OC |
| InChI | InChI=1S/C27H30B3N7O5/c1-14-11-37(12-15(2)41-14)13-22-34-26(42-36-22)17-5-4-6-19(23(17)40-3)32-20-9-21(33-24(38)16-7-8-16)31-10-18(20)25(39)35-27(28,29)30/h4-6,9-10,14-16H,7-8,11-13H2,1-3H3,(H,35,39)(H2,31,32,33,38)/t14-,15+ |
| InChIKey | UBLXKKMLEGWWMV-GASCZTMLSA-N |
| XLogP | 1.69 |
| TPSA | 143.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.02 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|