C21H21B3N6O5 — CID 174037173
CID 174037173 (PubChem CID 174037173) has the molecular formula C21H21B3N6O5 and a molecular weight of 469.87 g/mol.
| Compound Name | CID 174037173 |
|---|---|
| PubChem CID | 174037173 |
| Molecular Formula | C21H21B3N6O5 |
| Molecular Weight | 469.87 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1cnc(NC(=O)CC)cc1Nc1cccc(-c2noc(COC)n2)c1OC |
| InChI | InChI=1S/C21H21B3N6O5/c1-4-16(31)27-15-8-14(12(9-25-15)20(32)29-21(22,23)24)26-13-7-5-6-11(18(13)34-3)19-28-17(10-33-2)35-30-19/h5-9H,4,10H2,1-3H3,(H,29,32)(H2,25,26,27,31) |
| InChIKey | CYXOZXOKXCYYJE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.87 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|