C27H29B3N8O6 — CID 174036867
CID 174036867 (PubChem CID 174036867) has the molecular formula C27H29B3N8O6 and a molecular weight of 594.02 g/mol.
| Compound Name | CID 174036867 |
|---|---|
| PubChem CID | 174036867 |
| Molecular Formula | C27H29B3N8O6 |
| Molecular Weight | 594.02 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1cnc(NC(=O)C2CC2)cc1Nc1cccc(-c2noc(CN3CCN(C(=O)OC)CC3)n2)c1OC |
| InChI | InChI=1S/C27H29B3N8O6/c1-42-22-16(23-34-21(44-36-23)14-37-8-10-38(11-9-37)26(41)43-2)4-3-5-18(22)32-19-12-20(33-24(39)15-6-7-15)31-13-17(19)25(40)35-27(28,29)30/h3-5,12-13,15H,6-11,14H2,1-2H3,(H,35,40)(H2,31,32,33,39) |
| InChIKey | ZRNIDQANQIFTFW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 164.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.02 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|